| dbo:abstract
|
- رينزابرايد (بالإنجليزية: Renzapride) ويعرف بالاسم التجاري رينزابرايد (بالإنجليزية: Renzapride) هو دواء يساعد على تنظيم حركة الأمعاء، ويستخدم لعلاج التهاب المعدة، والارتجاع المعدي المريئي، عسر الهضم، أعراض القولون العصبي. (ar)
- Renzapride is a prokinetic agent and antiemetic which acts as a full 5-HT4 agonist and partial 5-HT3 antagonist. It also functions as a 5-HT2B antagonist and has some affinity for the 5-HT2A and 5-HT2C receptors. Renzapride was being developed by Alizyme plc of the United Kingdom. In May 2016, EndoLogic LLC, a US-based pharmaceutical and medical device company, acquired the US and worldwide patent rights to Renzapride. Endologic confirmed the cardiac safety of renzapride through a “Thorough QTc” study and sold the rights to Atlantic Healthcare plc in 2019, a specialist pharmaceutical company. Atlantic Healthcare is focusing on the development of renzapride for the management of gastrointestinal (GI) motility in a number of rare diseases, including systemic scleroderma and cystic fibrosis, both of which are associated with chronic GI motility problems and for which there are no approved therapies. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 8927 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:c
| |
| dbp:casNumber
|
- 109872 (xsd:integer)
- 112727 (xsd:integer)
|
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:cl
| |
| dbp:h
| |
| dbp:index2Label
| |
| dbp:iupacName
| |
| dbp:iupharLigand
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- Clc1ccCN[C@@H]3CC[N@]2C[C@@H]3CCC2 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- GZSKEXSLDPEFPT-IINYFYTJSA-N (en)
|
| dbp:unii
|
- 6 (xsd:integer)
- 9073 (xsd:integer)
|
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- رينزابرايد (بالإنجليزية: Renzapride) ويعرف بالاسم التجاري رينزابرايد (بالإنجليزية: Renzapride) هو دواء يساعد على تنظيم حركة الأمعاء، ويستخدم لعلاج التهاب المعدة، والارتجاع المعدي المريئي، عسر الهضم، أعراض القولون العصبي. (ar)
- Renzapride is a prokinetic agent and antiemetic which acts as a full 5-HT4 agonist and partial 5-HT3 antagonist. It also functions as a 5-HT2B antagonist and has some affinity for the 5-HT2A and 5-HT2C receptors. Renzapride was being developed by Alizyme plc of the United Kingdom. In May 2016, EndoLogic LLC, a US-based pharmaceutical and medical device company, acquired the US and worldwide patent rights to Renzapride. Endologic confirmed the cardiac safety of renzapride through a “Thorough QTc” study and sold the rights to Atlantic Healthcare plc in 2019, a specialist pharmaceutical company. (en)
|
| rdfs:label
|
- رينزابرايد (ar)
- Renzapride (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |