| Okaperidon
|
|
| IUPAC ime
|
| |
|---|
| 3-[2-[4-(6-Fluoro-1,2-benzoksazol-3-il)piperidin-1-il]etil]-2,9-dimetilpirido[1,2-a]pirimidin-4-on |
|
| Identifikacija
|
| CAS registarski broj
|
129029-23-8
|
| PubChem[1][2]
|
71351
|
| Jmol-3D slike
|
Slika 1
|
|
|---|
CC1=CC=CN2C1=NC(=C(C2=O)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F)C |
|
|
|---|
InChI=1S/C24H25FN4O2/c1-15-4-3-10-29-23(15)26-16(2)19(24(29)30)9-13-28-11-7-17(8-12-28)22-20-6-5-18(25)14-21(20)31-27-22/h3-6,10,14,17H,7-9,11-13H2,1-2H3
Kod: ZZQNEJILGNNOEP-UHFFFAOYSA-N |
|
| Svojstva
|
| Molekulska formula
|
C24H25FN4O2
|
| Molarna masa
|
420.48 g mol−1
|
|
Ukoliko nije drugačije napomenuto, podaci se odnose na standardno stanje (25 °C, 100 kPa) materijala
|
| Infobox references
|
Okaperidon je benzizoksazolni antipsihotik.[3]
- ↑ Li Q, Cheng T, Wang Y, Bryant SH (2010). „PubChem as a public resource for drug discovery.”. Drug Discov Today 15 (23-24): 1052-7. DOI:10.1016/j.drudis.2010.10.003. PMID 20970519. edit
- ↑ Evan E. Bolton, Yanli Wang, Paul A. Thiessen, Stephen H. Bryant (2008). „Chapter 12 PubChem: Integrated Platform of Small Molecules and Biological Activities”. Annual Reports in Computational Chemistry 4: 217-241. DOI:10.1016/S1574-1400(08)00012-1.
- ↑ Leysen, JE; Janssen, PM; Gommeren, W; Wynants, J; Pauwels, PJ; Janssen, PA (1992). „In vitro and in vivo receptor binding and effects on monoamine turnover in rat brain regions of the novel antipsychotics risperidone and ocaperidone”. Molecular pharmacology 41 (3): 494–508. PMID 1372084.
