| Property |
Value |
| dbo:abstract
|
- Le bénoxacor est un phytoprotecteur utilisé en combinaison avec les herbicides métolachlore ou S-métolachlor dans les préparations commerciales « Duelor + Safeneur », « Dual Gold safeneur » ou « Primextra + safeneur ». (fr)
- Le bénoxacor est un phytoprotecteur utilisé en combinaison avec les herbicides métolachlore ou S-métolachlor dans les préparations commerciales « Duelor + Safeneur », « Dual Gold safeneur » ou « Primextra + safeneur ». (fr)
|
| dbo:einecsNumber
| |
| dbo:inchi
|
- 1/C11H11Cl2NO2/c1-7-6-16-9-5-3-2-4-8(9)14(7)11(15)10(12)13/h2-5,7,10H,6H2,1H3/t7-/s3
|
| dbo:iupacName
|
- (RS)-4-dichloroacetyl-3,4-dihydro (fr)
- -3-methyl-2H-1,4-benzoxazine (fr)
- (RS)-4-dichloroacetyl-3,4-dihydro (fr)
- -3-methyl-2H-1,4-benzoxazine (fr)
|
| dbo:smiles
|
- C[C@H]2COC1=CC=CC=C1N2C(C(Cl)Cl)=O
|
| dbo:thumbnail
| |
| dbo:weight
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5803 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| prop-fr:c
| |
| prop-fr:cl
| |
| prop-fr:h
| |
| prop-fr:inchi
| |
| prop-fr:n
| |
| prop-fr:nomiupac
|
- -4 (xsd:integer)
- -3 (xsd:integer)
|
| prop-fr:o
| |
| prop-fr:smiles
|
- C[C@H]2COC1=CC=CC=C1N2C=O (fr)
- C[C@H]2COC1=CC=CC=C1N2C=O (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Le bénoxacor est un phytoprotecteur utilisé en combinaison avec les herbicides métolachlore ou S-métolachlor dans les préparations commerciales « Duelor + Safeneur », « Dual Gold safeneur » ou « Primextra + safeneur ». (fr)
- Le bénoxacor est un phytoprotecteur utilisé en combinaison avec les herbicides métolachlore ou S-métolachlor dans les préparations commerciales « Duelor + Safeneur », « Dual Gold safeneur » ou « Primextra + safeneur ». (fr)
|
| rdfs:label
|
- Bénoxacor (fr)
- Bénoxacor (fr)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |