| dbo:abstract
|
- Chloroprednisone is a topical glucocorticoid first reported in 1960. It is a chlorinated derivative of prednisone. The acetate ester prodrug, chloroprednisone 21-acetate, was sold under the brand name Topilan as an anti-inflammatory agent. There is little published about chloroprednisone. This may be due to limited activity topically because the skin lacks the necessary activating enzyme 11-Beta hydroxysteroid dehydrogenase. Systemically, this agent's activity on glucocorticoid receptors may not have competed with agents like fludrocortisone or dexamethasone. (en)
|
| dbo:atcCode
|
- (combination with antiinfectives)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3105 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:atcSupplemental
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:cl
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- O=C[C@@]3CC[C@H]2[C@@H]4C[C@H]\C1=C\C\C=C/[C@]1[C@H]4CC[C@@]23C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- NPSLCOWKFFNQKK-ZPSUVKRCSA-N (en)
|
| dbp:synonyms
| |
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Chloroprednisone is a topical glucocorticoid first reported in 1960. It is a chlorinated derivative of prednisone. The acetate ester prodrug, chloroprednisone 21-acetate, was sold under the brand name Topilan as an anti-inflammatory agent. There is little published about chloroprednisone. This may be due to limited activity topically because the skin lacks the necessary activating enzyme 11-Beta hydroxysteroid dehydrogenase. Systemically, this agent's activity on glucocorticoid receptors may not have competed with agents like fludrocortisone or dexamethasone. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |