[go: up one dir, main page]
Jump to content

Sulfaperin: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharmacology|er
 
(14 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}}
| Watchedfields = changed
⚫
| verifiedrevid = 443793085
⚫
| UNII = W5E840UV9P
⚫
| IUPAC_name = 4-amino-N-(5-methylpyrimidin-2-yl)benzenesulfonamide
⚫
| verifiedrevid = 408903857
⚫
| image = sulfaperine.png
⚫
| IUPAC_name = 4-amino-N-(5-methylpyrimidin-2-yl)benzenesulfonamide

⚫
| image = sulfaperine.png
<!--Clinical data-->
| tradename =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
⚫
| CAS_number_Ref = {{cascite|correct|CAS}}
⚫
| CAS_number = 599-88-2
⚫
| ATC_prefix = J01
⚫
| ATC_suffix = ED06
⚫
| PubChem = 68933
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 62158
| ChemSpiderID = 62158
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI = 1/C11H12N4O2S/c1-8-6-13-11(14-7-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)
⚫
| UNII = W5E840UV9P
| InChIKey = DZQVFHSCSRACSX-UHFFFAOYAW
| ChEBI = 131722
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| KEGG = D07240

<!--Chemical data-->
⚫
| C=11 | H=12 | N=4 | O=2 | S=1
| smiles = O=S(=O)(Nc1ncc(cn1)C)c2ccc(N)cc2
| smiles = O=S(=O)(Nc1ncc(cn1)C)c2ccc(N)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 15: Line 48:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DZQVFHSCSRACSX-UHFFFAOYSA-N
| StdInChIKey = DZQVFHSCSRACSX-UHFFFAOYSA-N
⚫
| CAS_number =
⚫
| ATC_prefix = J01
⚫
| ATC_suffix = ED06
⚫
| PubChem = 68933
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
⚫
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| KEGG = D07240
⚫
| C=11|H=12|N=4|O=2|S=1
| molecular_weight = 264.305 g/mol
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}


'''Sulfaperin''' (or '''sulfaperine''') is a [[sulfonamide (medicine)|sulfonamide]] [[antibacterial]].
'''Sulfaperin''' (or '''sulfaperine''') is a [[sulfonamide (medicine)|sulfonamide]] [[antibacterial]].<ref>{{cite book | vauthors = Elks J, Ganellin CR |title=Dictionary of drugs: Chemical Data, Structures, and Bibliographies |date=1990 |publisher=Springer |location=Dordrecht |isbn=978-1-4757-2085-3 |page=1129 |edition=First |url=https://books.google.com/books?id=0vXTBwAAQBAJ&dq=Sulfaperin&pg=PA1129}}</ref>



== References ==
{{Reflist}}


{{Sulfonamides and trimethoprim}}
{{Sulfonamides and trimethoprim}}
Line 49: Line 59:
[[Category:Pyrimidines]]
[[Category:Pyrimidines]]
[[Category:Sulfonamide antibiotics]]
[[Category:Sulfonamide antibiotics]]
[[Category:4-Aminophenyl compounds]]




{{antibiotic-stub}}
{{antibiotic-stub}}

[[th:ซัลฟาเพอริน]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"